EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO5 |
| Net Charge | 0 |
| Average Mass | 373.449 |
| Monoisotopic Mass | 373.18892 |
| SMILES | CCOC(=O)OC1=C(c2cc(C)ccc2C)C(=O)N[C@]12CC[C@@H](OC)CC2 |
| InChI | InChI=1S/C21H27NO5/c1-5-26-20(24)27-18-17(16-12-13(2)6-7-14(16)3)19(23)22-21(18)10-8-15(25-4)9-11-21/h6-7,12,15H,5,8-11H2,1-4H3,(H,22,23)/t15-,21+ |
| InChIKey | CLSVJBIHYWPGQY-GGYDESQDSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spirotetramat (CHEBI:81975) has role agrochemical (CHEBI:33286) |
| spirotetramat (CHEBI:81975) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| spirotetramat (CHEBI:81975) has role proinsecticide (CHEBI:136644) |
| spirotetramat (CHEBI:81975) is a azaspiro compound (CHEBI:35624) |
| spirotetramat (CHEBI:81975) is a benzenes (CHEBI:22712) |
| spirotetramat (CHEBI:81975) is a carbonate ester (CHEBI:46722) |
| spirotetramat (CHEBI:81975) is a pyrroles (CHEBI:26455) |
| spirotetramat (CHEBI:81975) is a γ-lactam (CHEBI:74222) |
| IUPAC Name |
|---|
| (5s,8s)-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl ethyl carbonate |
| Synonyms | Source |
|---|---|
| cis-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl ethyl carbonate | Alan Wood's Pesticides |
| ethyl cis-8-methoxy-2-oxo-3-(2,5-xylyl)-1-azaspiro[4.5]dec-3-en-4-yl carbonate | Alan Wood's Pesticides |
| cis-3-(2,5-dimethylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl ethylcarbonate | ChEBI |
| Brand Names | Source |
|---|---|
| Ultor | ChemIDplus |
| Movento | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18807 | KEGG COMPOUND |
| spirotetramat | Alan Wood's Pesticides |
| EP2039248 | Patent |
| 1119 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14441154 | Reaxys |
| CAS:203313-25-1 | KEGG COMPOUND |
| CAS:203313-25-1 | Alan Wood's Pesticides |
| CAS:203313-25-1 | ChemIDplus |
| Citations |
|---|