EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N4O3S |
| Net Charge | 0 |
| Average Mass | 316.427 |
| Monoisotopic Mass | 316.15691 |
| SMILES | CCCCc1c(C)nc(NCC)nc1OS(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H24N4O3S/c1-6-8-9-11-10(3)15-13(14-7-2)16-12(11)20-21(18,19)17(4)5/h6-9H2,1-5H3,(H,14,15,16) |
| InChIKey | DSKJPMWIHSOYEA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bupirimate (CHEBI:81952) has role androgen antagonist (CHEBI:35497) |
| bupirimate (CHEBI:81952) has role antifungal agrochemical (CHEBI:86328) |
| bupirimate (CHEBI:81952) is a aminopyrimidine (CHEBI:38338) |
| bupirimate (CHEBI:81952) is a pyrimidine fungicide (CHEBI:87207) |
| bupirimate (CHEBI:81952) is a secondary amino compound (CHEBI:50995) |
| bupirimate (CHEBI:81952) is a sulfamate ester (CHEBI:48199) |
| IUPAC Name |
|---|
| 5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl dimethylsulfamate |
| Synonyms | Source |
|---|---|
| 2-Äthylamino-5-butyl-4-yl-dimethylsulfamat | ChemIDplus |
| 5-Butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl dimethylsulfamate | ChemIDplus |
| 5-Butyl-2-ethylamino-6-methylpyrimidin-4-yl dimethylsulphamate | ChemIDplus |
| Dimethylsulfamic acid 5-butyl-2-(ethylamino)-6-methyl-4-pyrimidinyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 99 | PPDB |
| bupirimate | Alan Wood's Pesticides |
| Bupirimate | Wikipedia |
| C18776 | KEGG COMPOUND |
| CN101617658 | Patent |
| CN101632364 | Patent |
| CN101632374 | Patent |
| CN101647442 | Patent |
| CN101647443 | Patent |
| DE3441674 | Patent |
| GB2112287 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:758056 | Reaxys |
| CAS:41483-43-6 | ChemIDplus |
| CAS:41483-43-6 | KEGG COMPOUND |
| Citations |
|---|