EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6ClNO3S |
| Net Charge | 0 |
| Average Mass | 243.671 |
| Monoisotopic Mass | 242.97569 |
| SMILES | O=C(O)Cn1c(=O)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C9H6ClNO3S/c10-5-2-1-3-6-8(5)11(4-7(12)13)9(14)15-6/h1-3H,4H2,(H,12,13) |
| InChIKey | HYJSGOXICXYZGS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | herbicide A substance used to destroy plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benazolin (CHEBI:81951) has role herbicide (CHEBI:24527) |
| benazolin (CHEBI:81951) has role synthetic auxin (CHEBI:26841) |
| benazolin (CHEBI:81951) is a benzothiazoles (CHEBI:37947) |
| benazolin (CHEBI:81951) is a monocarboxylic acid (CHEBI:25384) |
| benazolin (CHEBI:81951) is a organochlorine pesticide (CHEBI:38656) |
| benazolin (CHEBI:81951) is conjugate acid of benazolin(1−) (CHEBI:132890) |
| Incoming Relation(s) |
| benazolin-ethyl (CHEBI:132897) has functional parent benazolin (CHEBI:81951) |
| benazolin(1−) (CHEBI:132890) is conjugate base of benazolin (CHEBI:81951) |
| IUPAC Name |
|---|
| (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid |
| Synonyms | Source |
|---|---|
| 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid | Alan Wood's Pesticides |
| 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid | Alan Wood's Pesticides |
| 4-chloro-2-oxobenzothiazolin-3-ylacetic acid | ChemIDplus |
| bénazoline | ChEBI |
| Citations |
|---|