EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10ClNO3S |
| Net Charge | 0 |
| Average Mass | 271.725 |
| Monoisotopic Mass | 271.00699 |
| SMILES | CCOC(=O)Cn1c(=O)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H10ClNO3S/c1-2-16-9(14)6-13-10-7(12)4-3-5-8(10)17-11(13)15/h3-5H,2,6H2,1H3 |
| InChIKey | WQRCEBAZAUAUQC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benazolin-ethyl (CHEBI:132897) has functional parent benazolin (CHEBI:81951) |
| benazolin-ethyl (CHEBI:132897) has role proherbicide (CHEBI:136646) |
| benazolin-ethyl (CHEBI:132897) has role synthetic auxin (CHEBI:26841) |
| benazolin-ethyl (CHEBI:132897) is a benzothiazoles (CHEBI:37947) |
| benazolin-ethyl (CHEBI:132897) is a ethyl ester (CHEBI:23990) |
| benazolin-ethyl (CHEBI:132897) is a organochlorine pesticide (CHEBI:38656) |
| IUPAC Name |
|---|
| ethyl (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetate |
| Synonyms | Source |
|---|---|
| ethyl 4-chloro-2-oxo-3(2H)-benzothiazoleacetate | Alan Wood's Pesticides |
| ethyl 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetate | Alan Wood's Pesticides |
| benazolin ethyl ester | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| derivatives/benazolin-ethyl | Alan Wood's Pesticides |
| 1086 | PPDB |
| Registry Numbers | Sources |
|---|---|
| CAS:25059-80-7 | Alan Wood's Pesticides |
| CAS:25059-80-7 | ChemIDplus |
| Citations |
|---|