EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6F17NO2S |
| Net Charge | 0 |
| Average Mass | 527.196 |
| Monoisotopic Mass | 526.98478 |
| SMILES | CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F17NO2S/c1-2-28-31(29,30)10(26,27)8(21,22)6(17,18)4(13,14)3(11,12)5(15,16)7(19,20)9(23,24)25/h28H,2H2,1H3 |
| InChIKey | CCEKAJIANROZEO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfluramid (CHEBI:81945) has functional parent ethylamine (CHEBI:15862) |
| sulfluramid (CHEBI:81945) has functional parent perfluorooctane-1-sulfonic acid (CHEBI:39421) |
| sulfluramid (CHEBI:81945) has role acaricide (CHEBI:22153) |
| sulfluramid (CHEBI:81945) has role environmental contaminant (CHEBI:78298) |
| sulfluramid (CHEBI:81945) has role insecticide (CHEBI:24852) |
| sulfluramid (CHEBI:81945) has role xenobiotic (CHEBI:35703) |
| sulfluramid (CHEBI:81945) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| Synonyms | Source |
|---|---|
| N-ethylperfluorooctane-1-sulfonamide | Alan Wood's Pesticides |
| N-Ethylperfluorooctylsulfonamide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 602 | PPDB |
| C18766 | KEGG COMPOUND |
| sulfluramid | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2317462 | Reaxys |
| CAS:4151-50-2 | ChemIDplus |
| CAS:4151-50-2 | KEGG COMPOUND |
| Citations |
|---|