EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39421 - perfluorooctane-1-sulfonic acid
| Formula | C8HF17O3S |
| Net Charge | 0 |
| Average Mass | 500.126 |
| Monoisotopic Mass | 499.93749 |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8HF17O3S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h(H,26,27,28) |
| InChIKey | YFSUTJLHUFNCNZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| Application: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorooctane-1-sulfonic acid (CHEBI:39421) has functional parent octane-1-sulfonic acid (CHEBI:39422) |
| perfluorooctane-1-sulfonic acid (CHEBI:39421) has role antilipemic drug (CHEBI:35679) |
| perfluorooctane-1-sulfonic acid (CHEBI:39421) has role persistent organic pollutant (CHEBI:77853) |
| perfluorooctane-1-sulfonic acid (CHEBI:39421) is a perfluoroalkanesulfonic acid (CHEBI:132447) |
| Incoming Relation(s) |
| perfluorooctane sulfonamidoacetic acid (CHEBI:83505) has functional parent perfluorooctane-1-sulfonic acid (CHEBI:39421) |
| sulfluramid (CHEBI:81945) has functional parent perfluorooctane-1-sulfonic acid (CHEBI:39421) |
| IUPAC Name |
|---|
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| perfluorooctylsulfonic acid | ChemIDplus |
| 1-perfluorooctanesulfonic acid | ChemIDplus |
| PFOS | ChemIDplus |
| heptadecafluoro-1-octanesulfonic acid | ChemIDplus |
| perfluorooctanesulfonic acid | HMDB |
| PFOS | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Perfluorooctanesulfonic_acid | Wikipedia |
| HMDB0059586 | HMDB |
| C18142 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Gmelin:580137 | Gmelin |
| Reaxys:1813859 | Reaxys |
| CAS:1763-23-1 | ChemIDplus |
| CAS:1763-23-1 | KEGG COMPOUND |