EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H9ClF3NO7 |
| Net Charge | 0 |
| Average Mass | 419.695 |
| Monoisotopic Mass | 419.00196 |
| SMILES | O=C(O)COC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9ClF3NO7/c17-11-5-8(16(18,19)20)1-4-13(11)28-9-2-3-12(21(25)26)10(6-9)15(24)27-7-14(22)23/h1-6H,7H2,(H,22,23) |
| InChIKey | DHAHEVIQIYRFRG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluoroglycofen (CHEBI:81921) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| fluoroglycofen (CHEBI:81921) has role herbicide (CHEBI:24527) |
| fluoroglycofen (CHEBI:81921) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluoroglycofen (CHEBI:81921) is a C-nitro compound (CHEBI:35716) |
| fluoroglycofen (CHEBI:81921) is a aromatic ether (CHEBI:35618) |
| fluoroglycofen (CHEBI:81921) is a benzoate ester (CHEBI:36054) |
| fluoroglycofen (CHEBI:81921) is a monocarboxylic acid (CHEBI:25384) |
| fluoroglycofen (CHEBI:81921) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| fluoroglycofen-ethyl (CHEBI:233301) has functional parent fluoroglycofen (CHEBI:81921) |
| IUPAC Name |
|---|
| ({5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl}oxy)acetic acid |
| Synonyms | Source |
|---|---|
| benzofluorfen | PPDB |
| carboxymethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate | Alan Wood's Pesticides |
| O-{5-[(2-chloro-α,α,α-trifluoro-p-tolyl)oxy]-2-nitrobenzoyl}glycolic acid | Alan Wood's Pesticides |
| fluoroglycofene | PPDB |
| fluoroglycoféne | ChEBI |
| Yisuofucaomi | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 339 | PPDB |
| C18732 | KEGG COMPOUND |
| fluoroglycofen | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8724259 | Reaxys |
| CAS:77501-60-1 | KEGG COMPOUND |
| Citations |
|---|