EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13ClF3NO7 |
| Net Charge | 0 |
| Average Mass | 447.749 |
| Monoisotopic Mass | 447.03326 |
| SMILES | CCOC(=O)COC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13ClF3NO7/c1-2-28-16(24)9-29-17(25)12-8-11(4-5-14(12)23(26)27)30-15-6-3-10(7-13(15)19)18(20,21)22/h3-8H,2,9H2,1H3 |
| InChIKey | IPPAUTOBDWNELX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluoroglycofen-ethyl (CHEBI:233301) has functional parent fluoroglycofen (CHEBI:81921) |
| fluoroglycofen-ethyl (CHEBI:233301) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| fluoroglycofen-ethyl (CHEBI:233301) has role herbicide (CHEBI:24527) |
| fluoroglycofen-ethyl (CHEBI:233301) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| fluoroglycofen-ethyl (CHEBI:233301) is a C-nitro compound (CHEBI:35716) |
| fluoroglycofen-ethyl (CHEBI:233301) is a aromatic ether (CHEBI:35618) |
| fluoroglycofen-ethyl (CHEBI:233301) is a benzoate ester (CHEBI:36054) |
| fluoroglycofen-ethyl (CHEBI:233301) is a ethyl ester (CHEBI:23990) |
| fluoroglycofen-ethyl (CHEBI:233301) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 2-ethoxy-2-oxoethyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate |
| Synonyms | Source |
|---|---|
| 2-ethoxy-2-oxoethyl 5-(2-chloro-4-(trifluoromethyl)phenoxy)-2-nitrobenzoate | ChEBI |
| RH0265 | ChEBI |
| RH 0265 | ChEBI |
| RH-0265 | ChEBI |
| fluoroglycofen ethyl ester | ChEBI |
| ethyl O-{5-[(2-chloro-α,α,α-trifluoro-p-tolyl)oxy]-2-nitrobenzoyl}glycolate | Alan Wood's Pesticides |
| Brand Names | Source |
|---|---|
| Compete | ChEBI |
| Simtar | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101622991 | Patent |
| CN101822261 | Patent |
| derivatives/fluoroglycofen-ethyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13251847 | Reaxys |
| CAS:77501-90-7 | NIST Chemistry WebBook |
| Citations |
|---|