EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O5/c1-2-3-9-14-19(23)15-10-6-4-5-7-11-16-20(24)21(25)17-12-8-13-18-22(26)27/h3-12,15-16,19-21,23-25H,2,13-14,17-18H2,1H3,(H,26,27)/b6-4-,7-5+,9-3-,12-8-,15-10+,16-11+/t19-,20+,21-/m0/s1 |
| InChIKey | OIWTWACQMDFHJG-CCFUIAGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (21359215) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin D1 (CHEBI:81564) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin D1 (CHEBI:81564) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin D1 (CHEBI:81564) is a resolvin (CHEBI:132120) |
| resolvin D1 (CHEBI:81564) is a triol (CHEBI:27136) |
| resolvin D1 (CHEBI:81564) is conjugate acid of resolvin D1(1−) (CHEBI:132079) |
| Incoming Relation(s) |
| resolvin D1(1−) (CHEBI:132079) is conjugate base of resolvin D1 (CHEBI:81564) |
| IUPAC Name |
|---|
| (4Z,7S,8R,9E,11E,13Z,15E,17S,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 7S,8,17S-Trihydroxy-docosa-4Z,9E,11E,13Z,15E,19Z-hexaenoate | HMDB |
| 7S,8,17S-Trihydroxy-docosa-4Z,9E,11E,13Z,15E,19Z-hexaenoic acid | HMDB |
| 7S,8R,17S-Trihydroxydocosa-4Z,9E,11E,13Z,15E,19Z-hexaenoic acid | KEGG COMPOUND |
| RvD1 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C18178 | KEGG COMPOUND |
| CPD66-64 | MetaCyc |
| HMDB0003733 | HMDB |
| LMFA04000006 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20871109 | Reaxys |
| Citations |
|---|