EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O5 |
| Net Charge | -1 |
| Average Mass | 375.485 |
| Monoisotopic Mass | 375.21770 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)C/C=C\CCC(=O)[O-] |
| InChI | InChI=1S/C22H32O5/c1-2-3-9-14-19(23)15-10-6-4-5-7-11-16-20(24)21(25)17-12-8-13-18-22(26)27/h3-12,15-16,19-21,23-25H,2,13-14,17-18H2,1H3,(H,26,27)/p-1/b6-4-,7-5+,9-3-,12-8-,15-10+,16-11+/t19-,20+,21-/m0/s1 |
| InChIKey | OIWTWACQMDFHJG-CCFUIAGSSA-M |
| Roles Classification |
|---|
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin D1(1−) (CHEBI:132079) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin D1(1−) (CHEBI:132079) is a hydroxy fatty acid anion (CHEBI:59835) |
| resolvin D1(1−) (CHEBI:132079) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| resolvin D1(1−) (CHEBI:132079) is conjugate base of resolvin D1 (CHEBI:81564) |
| Incoming Relation(s) |
| resolvin D1 (CHEBI:81564) is conjugate acid of resolvin D1(1−) (CHEBI:132079) |
| IUPAC Name |
|---|
| (4Z,7S,9E,11E,13Z,15E,17S,19Z)-7,8,17-trihydroxydocosa-4,9,11,13,15,19-hexaenoate |
| Synonym | Source |
|---|---|
| RvD1(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| resolvin D1 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0003733 | HMDB |
| Citations |
|---|