EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | CCOC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-4-3-5-8(10)6-7/h3-6H,2,10H2,1H3 |
| InChIKey | ZMCBYSBVJIMENC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | general anaesthetic Substance that produces loss of consciousness. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricaine (CHEBI:81494) has functional parent 3-aminobenzoic acid (CHEBI:42682) |
| tricaine (CHEBI:81494) has role general anaesthetic (CHEBI:38869) |
| tricaine (CHEBI:81494) is a benzoate ester (CHEBI:36054) |
| tricaine (CHEBI:81494) is a substituted aniline (CHEBI:48975) |
| tricaine (CHEBI:81494) is conjugate base of tricaine(1+) (CHEBI:131337) |
| Incoming Relation(s) |
| tricaine(1+) (CHEBI:131337) is conjugate acid of tricaine (CHEBI:81494) |
| IUPAC Name |
|---|
| ethyl 3-aminobenzoate |
| Synonyms | Source |
|---|---|
| 3-Aminobenzoic acid ethyl ester | ChemIDplus |
| 3-(Ethoxycarbonyl)aniline | ChemIDplus |
| AI3-02743 | ChemIDplus |
| Ethyl m-aminobenzoate | ChemIDplus |
| m-Aminobenzoic acid, ethyl ester | NIST Chemistry WebBook |
| metacaine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18090 | KEGG COMPOUND |
| FG7 | PDBeChem |
| Tricaine_mesylate | Wikipedia |