EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO2 |
| Net Charge | 0 |
| Average Mass | 137.138 |
| Monoisotopic Mass | 137.04768 |
| SMILES | Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C7H7NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,8H2,(H,9,10) |
| InChIKey | XFDUHJPVQKIXHO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-aminobenzoic acid (CHEBI:42682) has functional parent benzoic acid (CHEBI:30746) |
| 3-aminobenzoic acid (CHEBI:42682) is a aminobenzoic acid (CHEBI:22495) |
| 3-aminobenzoic acid (CHEBI:42682) is conjugate acid of 3-aminobenzoate (CHEBI:30761) |
| Incoming Relation(s) |
| 3-(oxaloamino)benzoic acid (CHEBI:30868) has functional parent 3-aminobenzoic acid (CHEBI:42682) |
| tricaine (CHEBI:81494) has functional parent 3-aminobenzoic acid (CHEBI:42682) |
| 3-aminobenzoate (CHEBI:30761) is conjugate base of 3-aminobenzoic acid (CHEBI:42682) |
| IUPAC Name |
|---|
| 3-aminobenzoic acid |
| Synonyms | Source |
|---|---|
| m-aminobenzoic acid | NIST Chemistry WebBook |
| 3-carboxyaniline | NIST Chemistry WebBook |
| m-carboxyaniline | NIST Chemistry WebBook |
| MABA | ChemIDplus |
| 3-AMINOBENZOIC ACID | PDBeChem |
| m-Aminobenzoesäure | ChEBI |
| Citations |
|---|