EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81481 - 11β-hydroxytestosterone
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H28O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h9,13-17,21-22H,3-8,10H2,1-2H3/t13-,14-,15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | YQDZGFAYWGWSJK-SLMGBJJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gobius niger (ncbitaxon:85417)) | - | PubMed (2514969) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (217678) | |
| Ictalurus punctatus (ncbitaxon:7998) | - | PubMed (9679086) | |
| Clarias batrachus (ncbitaxon:59899) | - | PubMed (25452027) | |
| Nostoc muscorum (ncbitaxon:1179) | - | PubMed (15587704) | |
| Anguilla japonica (ncbitaxon:7937) | - | PubMed (16887910) |
| Roles Classification |
|---|
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11β-hydroxytestosterone (CHEBI:81481) has functional parent testosterone (CHEBI:17347) |
| 11β-hydroxytestosterone (CHEBI:81481) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 11β-hydroxytestosterone (CHEBI:81481) has role human xenobiotic metabolite (CHEBI:76967) |
| 11β-hydroxytestosterone (CHEBI:81481) has role marine metabolite (CHEBI:76507) |
| 11β-hydroxytestosterone (CHEBI:81481) is a 11β-hydroxy steroid (CHEBI:35346) |
| 11β-hydroxytestosterone (CHEBI:81481) is a 17β-hydroxy steroid (CHEBI:35343) |
| 11β-hydroxytestosterone (CHEBI:81481) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| 11β-hydroxytestosterone (CHEBI:81481) is a androstanoid (CHEBI:50402) |
| 11β-hydroxytestosterone (CHEBI:81481) is a C19-steroid (CHEBI:131621) |
| IUPAC Name |
|---|
| 11β,17β-dihydroxyandrost-4-ene-3-one |
| Synonyms | Source |
|---|---|
| 11beta-Hydroxytestosterone | KEGG COMPOUND |
| 11-Hydroxytestosterone | ChemIDplus |
| (11β,17β)-11,17-dihydroxyandrost-4-en-3-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 11β,17β-dihydroxyandrost-4-ene-3-one | UniProt |
| Citations |
|---|