EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(-c2coc3cc(O)c(OC)c(O)c3c2=O)cc(O)c1OC |
| InChI | InChI=1S/C18H16O8/c1-23-13-5-8(4-10(19)17(13)24-2)9-7-26-12-6-11(20)18(25-3)16(22)14(12)15(9)21/h4-7,19-20,22H,1-3H3 |
| InChIKey | TUGWPJJTQNLKCL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Iris domestica (ncbitaxon:58944) | - | PubMed (25036154) | |
| Iris germanica (ncbitaxon:34205) | rhizome (BTO:0001181) | PubMed (25204177) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irigenin (CHEBI:81409) has functional parent isoflavone (CHEBI:18220) |
| irigenin (CHEBI:81409) has role plant metabolite (CHEBI:76924) |
| irigenin (CHEBI:81409) is a 4'-methoxyisoflavones (CHEBI:133959) |
| irigenin (CHEBI:81409) is a hydroxyisoflavone (CHEBI:38755) |
| Incoming Relation(s) |
| iridin (CHEBI:5963) has functional parent irigenin (CHEBI:81409) |
| Synonym | Source |
|---|---|
| 5,7,3'-trihydroxy-6,4',5'-trimethoxyisoflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C17957 | KEGG COMPOUND |
| Irigenin | Wikipedia |
| LMPK12050417 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:345805 | Reaxys |
| CAS:548-76-5 | KEGG COMPOUND |
| CAS:548-76-5 | ChemIDplus |
| Citations |
|---|