EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O13 |
| Net Charge | 0 |
| Average Mass | 522.459 |
| Monoisotopic Mass | 522.13734 |
| SMILES | COc1cc(-c2coc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(OC)c(O)c3c2=O)cc(O)c1OC |
| InChI | InChI=1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1 |
| InChIKey | LNQCUTNLHUQZLR-OZJWLQQPSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Iris germanica (ncbitaxon:34205) | rhizome (BTO:0001181) | PubMed (22388969) | |
| Iris domestica (ncbitaxon:58944) | - | PubMed (21465599) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iridin (CHEBI:5963) has functional parent irigenin (CHEBI:81409) |
| iridin (CHEBI:5963) has role plant metabolite (CHEBI:76924) |
| iridin (CHEBI:5963) is a 4'-methoxyisoflavones (CHEBI:133959) |
| iridin (CHEBI:5963) is a 7-hydroxyisoflavones 7-O-β-D-glucoside (CHEBI:140301) |
| iridin (CHEBI:5963) is a hydroxyisoflavone (CHEBI:38755) |
| iridin (CHEBI:5963) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| irigenin 7-O-glucoside | KNApSAcK |
| irigenin 7-O-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10465 | KEGG COMPOUND |
| C00010137 | KNApSAcK |
| Iridin | Wikipedia |
| LMPK12050415 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:71893 | Reaxys |
| CAS:491-74-7 | KEGG COMPOUND |
| CAS:491-74-7 | ChemIDplus |
| Citations |
|---|