EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O10 |
| Net Charge | 0 |
| Average Mass | 448.424 |
| Monoisotopic Mass | 448.13695 |
| SMILES | COc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2c(c1)O[C@H](c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C22H24O10/c1-29-12-6-15-18(13(25)8-14(30-15)10-2-4-11(24)5-3-10)16(7-12)31-22-21(28)20(27)19(26)17(9-23)32-22/h2-7,14,17,19-24,26-28H,8-9H2,1H3/t14-,17+,19+,20-,21+,22+/m0/s1 |
| InChIKey | NEPMMBQHELYZIW-YMTXFHFDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Populus tomentosa (ncbitaxon:118781) | - | PubMed (22860454) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sakuranin (CHEBI:81054) has functional parent sakuranetin (CHEBI:28927) |
| sakuranin (CHEBI:81054) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| sakuranin (CHEBI:81054) has role plant metabolite (CHEBI:76924) |
| sakuranin (CHEBI:81054) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sakuranin (CHEBI:81054) is a flavanone glycoside (CHEBI:72730) |
| sakuranin (CHEBI:81054) is a monohydroxyflavanone (CHEBI:38748) |
| sakuranin (CHEBI:81054) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-2-(4-hydroxyphenyl)-7-methoxy-4-oxo-3,4-dihydro-2H-1-benzopyran-5-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| NSC 407308 | KEGG COMPOUND |
| (S)-5-β-D-glucopyranosyloxy-2-(4-hydroxy-phenyl)-7-methoxy-chroman-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C17391 | KEGG COMPOUND |
| C00008219 | KNApSAcK |
| LMPK12140564 | LIPID MAPS |
| Sakuranin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100817 | Reaxys |
| CAS:529-39-5 | KEGG COMPOUND |
| CAS:529-39-5 | ChemIDplus |
| Citations |
|---|