EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O10 |
| Net Charge | 0 |
| Average Mass | 448.424 |
| Monoisotopic Mass | 448.13695 |
| SMILES | COc1cc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c2c(c1)O[C@H](c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C22H24O10/c1-29-12-6-15-18(13(25)8-14(30-15)10-2-4-11(24)5-3-10)16(7-12)31-22-21(28)20(27)19(26)17(9-23)32-22/h2-7,14,17,19-24,26-28H,8-9H2,1H3/t14-,17+,19+,20-,21+,22+/m0/s1 |
| InChIKey | NEPMMBQHELYZIW-YMTXFHFDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Populus tomentosa (ncbitaxon:118781) | - | PubMed (22860454) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sakuranin (CHEBI:81054) has functional parent sakuranetin (CHEBI:28927) |
| sakuranin (CHEBI:81054) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| sakuranin (CHEBI:81054) has role plant metabolite (CHEBI:76924) |
| sakuranin (CHEBI:81054) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sakuranin (CHEBI:81054) is a flavanone glycoside (CHEBI:72730) |
| sakuranin (CHEBI:81054) is a monohydroxyflavanone (CHEBI:38748) |
| sakuranin (CHEBI:81054) is a monomethoxyflavanone (CHEBI:38738) |
| IUPAC Name |
|---|
| (2S)-2-(4-hydroxyphenyl)-7-methoxy-4-oxo-3,4-dihydro-2H-1-benzopyran-5-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (S)-5-β-D-glucopyranosyloxy-2-(4-hydroxy-phenyl)-7-methoxy-chroman-4-one | ChEBI |
| NSC 407308 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00008219 | KNApSAcK |
| C17391 | KEGG COMPOUND |
| LMPK12140564 | LIPID MAPS |
| Sakuranin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:100817 | Reaxys |
| CAS:529-39-5 | KEGG COMPOUND |
| CAS:529-39-5 | ChemIDplus |
| Citations |
|---|