EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1cc(O)c2c(c1)O[C@H](c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| InChIKey | DJOJDHGQRNZXQQ-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Roles: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sakuranetin (CHEBI:28927) has functional parent (S)-naringenin (CHEBI:17846) |
| sakuranetin (CHEBI:28927) has role antimycobacterial drug (CHEBI:64912) |
| sakuranetin (CHEBI:28927) has role plant metabolite (CHEBI:76924) |
| sakuranetin (CHEBI:28927) is a (2S)-flavan-4-one (CHEBI:140377) |
| sakuranetin (CHEBI:28927) is a 4'-hydroxyflavanones (CHEBI:140331) |
| sakuranetin (CHEBI:28927) is a dihydroxyflavanone (CHEBI:38749) |
| sakuranetin (CHEBI:28927) is a flavonoid phytoalexin (CHEBI:60951) |
| sakuranetin (CHEBI:28927) is a monomethoxyflavanone (CHEBI:38738) |
| Incoming Relation(s) |
| sakuranin (CHEBI:81054) has functional parent sakuranetin (CHEBI:28927) |
| IUPAC Name |
|---|
| (2S)-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',5-dihydroxy-7-methoxyflavanone | IUPHAR |
| 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-chroman-4-one | IUPHAR |
| (S)-2,3-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | ChemIDplus |
| (S)-(−)-4',5-dihydroxy-7-methoxyflavanone | ChemIDplus |
| Naringenin 7-methyl ether | KEGG COMPOUND |
| Sakuranetin | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| (2S)-sakuranetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000999 | KNApSAcK |
| C09833 | KEGG COMPOUND |
| CPD-7079 | MetaCyc |
| HMDB0030090 | HMDB |
| LMPK12140571 | LIPID MAPS |
| SAK | PDBeChem |
| Sakuranetin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:92466 | Reaxys |
| CAS:2957-21-3 | KEGG COMPOUND |
| CAS:2957-21-3 | ChemIDplus |
| Citations |
|---|