EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81024 - nocardicin G
| Formula | C19H19N3O6 |
| Net Charge | 0 |
| Average Mass | 385.376 |
| Monoisotopic Mass | 385.12739 |
| SMILES | N[C@@H](C(=O)N[C@H]1CN([C@@H](C(=O)O)c2ccc(O)cc2)C1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H19N3O6/c20-15(10-1-5-12(23)6-2-10)17(25)21-14-9-22(18(14)26)16(19(27)28)11-3-7-13(24)8-4-11/h1-8,14-16,23-24H,9,20H2,(H,21,25)(H,27,28)/t14-,15+,16+/m0/s1 |
| InChIKey | SAVAPYNOQXYBJS-ARFHVFGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardia uniformis subsp. tsuyamanensis (ncbitaxon:96045) | - | PubMed (15629944) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocardicin G (CHEBI:81024) has role bacterial metabolite (CHEBI:76969) |
| nocardicin G (CHEBI:81024) is a monobactam (CHEBI:50695) |
| nocardicin G (CHEBI:81024) is a oxo monocarboxylic acid (CHEBI:35871) |
| nocardicin G (CHEBI:81024) is a polyphenol (CHEBI:26195) |
| nocardicin G (CHEBI:81024) is a secondary amino compound (CHEBI:50995) |
| nocardicin G (CHEBI:81024) is tautomer of nocardicin G zwitterion (CHEBI:131919) |
| Incoming Relation(s) |
| nocardicin G zwitterion (CHEBI:131919) is tautomer of nocardicin G (CHEBI:81024) |
| IUPAC Name |
|---|
| (2R)-[(3S)-3-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-2-oxoazetidin-1-yl](4-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| FR 29644 | ChemIDplus |
| Antibiotic FR 29644 | ChemIDplus |
| (−)-nocardicin G | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3572724 | Reaxys |
| CAS:65309-11-7 | KEGG COMPOUND |
| CAS:65309-11-7 | ChemIDplus |
| Citations |
|---|