EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O6 |
| Net Charge | 0 |
| Average Mass | 385.376 |
| Monoisotopic Mass | 385.12739 |
| SMILES | [NH3+][C@@H](C(=O)N[C@H]1CN([C@@H](C(=O)[O-])c2ccc(O)cc2)C1=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H19N3O6/c20-15(10-1-5-12(23)6-2-10)17(25)21-14-9-22(18(14)26)16(19(27)28)11-3-7-13(24)8-4-11/h1-8,14-16,23-24H,9,20H2,(H,21,25)(H,27,28)/t14-,15+,16+/m0/s1 |
| InChIKey | SAVAPYNOQXYBJS-ARFHVFGLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nocardicin G zwitterion (CHEBI:131919) is a amino-acid zwitterion (CHEBI:35238) |
| nocardicin G zwitterion (CHEBI:131919) is tautomer of nocardicin G (CHEBI:81024) |
| Incoming Relation(s) |
| nocardicin G (CHEBI:81024) is tautomer of nocardicin G zwitterion (CHEBI:131919) |
| IUPAC Name |
|---|
| (2R)-[(3S)-3-{[(2R)-2-azaniumyl-2-(4-hydroxyphenyl)acetyl]amino}-2-oxoazetidin-1-yl](4-hydroxyphenyl)acetate |
| UniProt Name | Source |
|---|---|
| nocardicin G | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9418 | MetaCyc |