EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:28044 - phenylalanine
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| InChIKey | COLNVLDHVKWLRT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylalanine (CHEBI:28044) has part benzyl group (CHEBI:22744) |
| phenylalanine (CHEBI:28044) has role Daphnia magna metabolite (CHEBI:83056) |
| phenylalanine (CHEBI:28044) is a aromatic amino acid (CHEBI:33856) |
| phenylalanine (CHEBI:28044) is a α-amino acid (CHEBI:33704) |
| phenylalanine (CHEBI:28044) is conjugate acid of phenylalaninate (CHEBI:32504) |
| phenylalanine (CHEBI:28044) is conjugate base of phenylalaninium (CHEBI:32505) |
| Incoming Relation(s) |
| 4-nitrophenylalanine (CHEBI:48496) has functional parent phenylalanine (CHEBI:28044) |
| methyl 4-amino-N-(tert-butoxycarbonyl)phenylalaninate (CHEBI:48493) has functional parent phenylalanine (CHEBI:28044) |
| phenylalanine derivative (CHEBI:25985) has functional parent phenylalanine (CHEBI:28044) |
| γ-glutamylphenylalanine (CHEBI:82966) has functional parent phenylalanine (CHEBI:28044) |
| D-phenylalanine (CHEBI:16998) is a phenylalanine (CHEBI:28044) |
| L-phenylalanine (CHEBI:17295) is a phenylalanine (CHEBI:28044) |
| phenylalaninium (CHEBI:32505) is conjugate acid of phenylalanine (CHEBI:28044) |
| phenylalaninate (CHEBI:32504) is conjugate base of phenylalanine (CHEBI:28044) |
| phenylalanine residue (CHEBI:32503) is substituent group from phenylalanine (CHEBI:28044) |
| phenylalanino group (CHEBI:25986) is substituent group from phenylalanine (CHEBI:28044) |
| phenylalanyl group (CHEBI:25987) is substituent group from phenylalanine (CHEBI:28044) |
| IUPAC Names |
|---|
| 2-amino-3-phenylpropanoic acid |
| phenylalanine |
| Synonyms | Source |
|---|---|
| alpha-Amino-beta-phenylpropionic acid | KEGG COMPOUND |
| DL-Phenylalanine | KEGG COMPOUND |
| F | ChEBI |
| fenilalanina | ChEBI |
| PHE | ChEBI |
| Phenylalanin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02057 | KEGG COMPOUND |
| Phenylalanine | Wikipedia |
| Citations |
|---|