EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O10 |
| Net Charge | 0 |
| Average Mass | 424.402 |
| Monoisotopic Mass | 424.13695 |
| SMILES | [H][C@@]1(C(C)(C)C)[C@@H](O)[C@@]2([H])OC(=O)[C@@]34O[C@@H]5OC(=O)[C@H](O)C51C32[C@@H](O)[C@]1([H])OC(=O)[C@@H](C)[C@@]14[H] |
| InChI | InChI=1S/C20H24O10/c1-5-6-8(27-13(5)24)10(22)19-12-7(21)9(17(2,3)4)18(19)11(23)14(25)29-16(18)30-20(6,19)15(26)28-12/h5-12,16,21-23H,1-4H3/t5-,6-,7+,8+,9-,10-,11-,12+,16-,18?,19?,20+/m0/s1 |
| InChIKey | KDKROYXEHCYLJQ-DYXVGVPESA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ginkgolide M (CHEBI:80750) is a diterpene lactone (CHEBI:49193) |
| Ginkgolide M (CHEBI:80750) is a ginkgolide (CHEBI:136909) |
| Manual Xrefs | Databases |
|---|---|
| C16816 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:15291-78-8 | KEGG COMPOUND |