EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7N5O2 |
| Net Charge | 0 |
| Average Mass | 193.166 |
| Monoisotopic Mass | 193.05997 |
| SMILES | Cn1ncnc2c(=O)n(C)c(=O)nc1-2 |
| InChI | InChI=1S/C7H7N5O2/c1-11-6(13)4-5(10-7(11)14)12(2)9-3-8-4/h3H,1-2H3 |
| InChIKey | SLGRAIAQIAUZAQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia gladioli (ncbitaxon:28095) | - | PubMed (5905124) | |
| Burkholderia glumae (ncbitaxon:337) | - | Article (Jeong, Y., Kim, J., Kim, S., and Kang, Y (2003). Toxoflavin Produced by Burkholderia glumae Causing Rice Grain Rot Is Responsible for Inducing Bacterial Wilt in Many Field Crops. Plant Disease, Vol. 87 (8). p 890-895.) |
| Roles Classification |
|---|
| Biological Roles: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. virulence factor Any toxin secreted by bacteria, viruses, fungi or protozoa enabling them to achieve colonisation of a niche in the host, inhibit or evade the host's immune response, enter and exit cells, or obtain nutrition from the host. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| toxoflavin (CHEBI:80729) has functional parent reumycin (CHEBI:121196) |
| toxoflavin (CHEBI:80729) has role antibacterial agent (CHEBI:33282) |
| toxoflavin (CHEBI:80729) has role antineoplastic agent (CHEBI:35610) |
| toxoflavin (CHEBI:80729) has role apoptosis inducer (CHEBI:68495) |
| toxoflavin (CHEBI:80729) has role bacterial metabolite (CHEBI:76969) |
| toxoflavin (CHEBI:80729) has role toxin (CHEBI:27026) |
| toxoflavin (CHEBI:80729) has role virulence factor (CHEBI:72316) |
| toxoflavin (CHEBI:80729) has role Wnt signalling inhibitor (CHEBI:78031) |
| toxoflavin (CHEBI:80729) is a carbonyl compound (CHEBI:36586) |
| toxoflavin (CHEBI:80729) is a pyrimidotriazine (CHEBI:131697) |
| IUPAC Name |
|---|
| 1,6-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7(1H,6H)-dione |
| Synonyms | Source |
|---|---|
| 1,6-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7-dione | ChEBI |
| 1,6-dimethylpyrimido(5,4-e)-as-triazine-5,7(1H,6H)-dione | ChemIDplus |
| 1-methylreumycin | ChEBI |
| NC72 | ChEBI |
| NSC67078 | ChEBI |
| PKF118-310 | ChEBI |
| UniProt Name | Source |
|---|---|
| toxoflavin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C16789 | KEGG COMPOUND |
| CPD-21056 | MetaCyc |
| Toxoflavin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21014 | Reaxys |
| CAS:84-82-2 | ChemIDplus |
| CAS:84-82-2 | KEGG COMPOUND |
| Citations |
|---|