EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5N5O2 |
| Net Charge | 0 |
| Average Mass | 179.139 |
| Monoisotopic Mass | 179.04432 |
| SMILES | Cn1c(=O)nc2nncnc2c1=O |
| InChI | InChI=1S/C6H5N5O2/c1-11-5(12)3-4(9-6(11)13)10-8-2-7-3/h2H,1H3,(H,9,10,13) |
| InChIKey | ZLLAXLPOOMLVRF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomyces (ncbitaxon:1654) | - | PubMed (4792066) | Obtained from a strain of Actinomyces isolated from Kazakhstan soil. |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reumycin (CHEBI:121196) has functional parent 1,6-didemethyltoxoflavin (CHEBI:141050) |
| reumycin (CHEBI:121196) has role antimicrobial agent (CHEBI:33281) |
| reumycin (CHEBI:121196) has role antineoplastic agent (CHEBI:35610) |
| reumycin (CHEBI:121196) has role bacterial metabolite (CHEBI:76969) |
| reumycin (CHEBI:121196) is a carbonyl compound (CHEBI:36586) |
| reumycin (CHEBI:121196) is a pyrimidotriazine (CHEBI:131697) |
| Incoming Relation(s) |
| toxoflavin (CHEBI:80729) has functional parent reumycin (CHEBI:121196) |
| IUPAC Name |
|---|
| 6-methylpyrimido[5,4-e][1,2,4]triazine-5,7(6H,8H)-dione |
| Synonyms | Source |
|---|---|
| 1-demethyltoxoflavin | MetaCyc |
| 6-methyl-8H-pyrimido[5,4-e][1,2,4]triazine-5,7-dione | LINCS |
| 6-methyl-pyrimido-[5,4-e]-as-triazine-5,7(6H,8H)-dione | ChEBI |
| reumicine | ChEBI |
| reumitsin | ChemIDplus |
| rheumycin | ChEBI |
| UniProt Name | Source |
|---|---|
| reumycin | UniProt |
| Citations |
|---|