EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N2O3.Na |
| Net Charge | 0 |
| Average Mass | 254.221 |
| Monoisotopic Mass | 254.06674 |
| SMILES | CCC1(c2ccccc2)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C12H12N2O3.Na/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;/h3-7H,2H2,1H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| InChIKey | WRLGYAWRGXKSKG-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Application: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenobarbital sodium (CHEBI:8070) has part phenobarbital (CHEBI:8069) |
| phenobarbital sodium (CHEBI:8070) is a barbiturates (CHEBI:22693) |
| phenobarbital sodium (CHEBI:8070) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 5-ethyl-4,6-dioxo-5-phenyl-1,4,5,6-tetrahydropyrimidin-2-olate |
| INNs | Source |
|---|---|
| phenobarbital sodique | ChemIDplus |
| phenobarbital sodium | ChemIDplus |
| phenobarbitalum natricum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Ethyl-5-phenylbarbituric acid sodium salt | ChemIDplus |
| Phenobarbital sodium salt | ChemIDplus |
| Phenyl-äthyl-barbitursäure natrium | ChemIDplus |
| Sodium 5-ethyl-5-phenylbarbiturate | ChemIDplus |
| Sodium luminal | ChemIDplus |
| Sodium phenobarbital | ChemIDplus |
| Brand Name | Source |
|---|---|
| Luminal sodium | KEGG DRUG |
| Citations |
|---|