EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8069 - phenobarbital
| Formula | C12H12N2O3 |
| Net Charge | 0 |
| Average Mass | 232.239 |
| Monoisotopic Mass | 232.08479 |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | DDBREPKUVSBGFI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. excitatory amino acid antagonist Any substance which inhibits the action of receptors for excitatory amino acids. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. drug allergen Any drug which causes the onset of an allergic reaction. anticonvulsant A drug used to prevent seizures or reduce their severity. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenobarbital (CHEBI:8069) has role anticonvulsant (CHEBI:35623) |
| phenobarbital (CHEBI:8069) has role drug allergen (CHEBI:88188) |
| phenobarbital (CHEBI:8069) has role excitatory amino acid antagonist (CHEBI:60798) |
| phenobarbital (CHEBI:8069) has role sedative (CHEBI:35717) |
| phenobarbital (CHEBI:8069) is a barbiturates (CHEBI:22693) |
| Incoming Relation(s) |
| phenobarbital sodium (CHEBI:8070) has part phenobarbital (CHEBI:8069) |
| IUPAC Name |
|---|
| 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione |
| INN | Source |
|---|---|
| phenobarbital | ChemIDplus |
| Synonyms | Source |
|---|---|
| Phenobarbital | KEGG COMPOUND |
| 5-Ethyl-5-phenylbarbituric acid | ChemIDplus |
| 5-Phenyl-5-ethylbarbituric acid | ChemIDplus |
| 5-ethyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione | NIST Chemistry WebBook |
| Phenobarbitol | DrugBank |
| Phenobarbituric Acid | DrugBank |
| Brand Name | Source |
|---|---|
| Luminal | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C07434 | KEGG COMPOUND |
| D00506 | KEGG DRUG |
| DB01174 | DrugBank |
| US1025872 | Patent |
| Phenobarbital | Wikipedia |
| HMDB0015305 | HMDB |
| 2134 | DrugCentral |
| Citations |
|---|