EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O3 |
| Net Charge | 0 |
| Average Mass | 232.239 |
| Monoisotopic Mass | 232.08479 |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H12N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h3-7H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | DDBREPKUVSBGFI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | excitatory amino acid antagonist Any substance which inhibits the action of receptors for excitatory amino acids. drug allergen Any drug which causes the onset of an allergic reaction. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. anticonvulsant A drug used to prevent seizures or reduce their severity. drug allergen Any drug which causes the onset of an allergic reaction. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenobarbital (CHEBI:8069) has role anticonvulsant (CHEBI:35623) |
| phenobarbital (CHEBI:8069) has role antidepressant (CHEBI:35469) |
| phenobarbital (CHEBI:8069) has role antineoplastic agent (CHEBI:35610) |
| phenobarbital (CHEBI:8069) has role antipsychotic agent (CHEBI:35476) |
| phenobarbital (CHEBI:8069) has role anxiolytic drug (CHEBI:35474) |
| phenobarbital (CHEBI:8069) has role drug allergen (CHEBI:88188) |
| phenobarbital (CHEBI:8069) has role excitatory amino acid antagonist (CHEBI:60798) |
| phenobarbital (CHEBI:8069) has role sedative (CHEBI:35717) |
| phenobarbital (CHEBI:8069) is a barbiturates (CHEBI:22693) |
| Incoming Relation(s) |
| phenobarbital sodium (CHEBI:8070) has part phenobarbital (CHEBI:8069) |
| IUPAC Name |
|---|
| 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione |
| INNs | Source |
|---|---|
| fenobarbital | WHO MedNet |
| phenobarbital | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-ethyl-5-phenyl-2,4,6(1H,3H,5H)-pyrimidinetrione | NIST Chemistry WebBook |
| 5-Ethyl-5-phenylbarbituric acid | ChemIDplus |
| 5-ethyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione | ChEMBL |
| 5-Ethyl-5-phenyl-pyrimidine-2,4,6-trione | ChEMBL |
| 5-Phenyl-5-ethylbarbituric acid | ChemIDplus |
| NSC-128143 | ChEMBL |
| Brand Names | Source |
|---|---|
| Gardenal | ChEMBL |
| Luminal | DrugBank |
| Noptil | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2134 | DrugCentral |
| C07434 | KEGG COMPOUND |
| D00506 | KEGG DRUG |
| DB01174 | DrugBank |
| HMDB0015305 | HMDB |
| Phenobarbital | Wikipedia |
| US1025872 | Patent |
| Citations |
|---|