EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O11 |
| Net Charge | 0 |
| Average Mass | 518.515 |
| Monoisotopic Mass | 518.17881 |
| SMILES | CC(C)=CCc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c2c1O[C@H](c1ccc(O)cc1)[C@@H](O)C2=O |
| InChI | InChI=1S/C26H30O11/c1-11(2)3-8-14-16(35-26-23(34)21(32)19(30)17(10-27)36-26)9-15(29)18-20(31)22(33)24(37-25(14)18)12-4-6-13(28)7-5-12/h3-7,9,17,19,21-24,26-30,32-34H,8,10H2,1-2H3/t17-,19-,21+,22+,23-,24-,26-/m1/s1 |
| InChIKey | GRDZTDZJQRPNCN-YIANMRPHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Commiphora africana (ncbitaxon:181237) | stem wood (BTO:0001469) | PubMed (15679332) | |
| Phellodendron amurense (ncbitaxon:68554) | - | DOI (10.1016/S0031-9422(00)91328-1) | |
| Phellodendron wilsonii (IPNI:774789-1) | leaf (BTO:0000713) | PubMed (11859464) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phellamurin (CHEBI:8048) has functional parent (+)-dihydrokaempferol (CHEBI:15401) |
| phellamurin (CHEBI:8048) has role metabolite (CHEBI:25212) |
| phellamurin (CHEBI:8048) is a 4'-hydroxyflavanones (CHEBI:140331) |
| phellamurin (CHEBI:8048) is a dihydroflavonols (CHEBI:48039) |
| phellamurin (CHEBI:8048) is a flavanone glycoside (CHEBI:72730) |
| phellamurin (CHEBI:8048) is a monosaccharide derivative (CHEBI:63367) |
| phellamurin (CHEBI:8048) is a trihydroxyflavanone (CHEBI:38739) |
| phellamurin (CHEBI:8048) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (2R,3R)-3,5-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-3,4-dihydro-2H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3,5,7,4'-tetrahydroxy-8-(3-methylbut-2-enyl)flavanone-7-O-β-glucoside | ChEBI |
| 8-Prenyldihydrokaempferol 7-glucoside | KEGG COMPOUND |
| Fellavine | ChemIDplus |
| Phellamurin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00000989 | KNApSAcK |
| C09808 | KEGG COMPOUND |
| Phellamurin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9458481 | Reaxys |
| CAS:52589-11-4 | KEGG COMPOUND |
| CAS:52589-11-4 | ChemIDplus |
| Citations |
|---|