EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C1c2c(O)cc(O)cc2O[C@H](c2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H/t14-,15+/m0/s1 |
| InChIKey | PADQINQHPQKXNL-LSDHHAIUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pittocaulon velatum (IPNI:238587-1) | |||
| stem (BTO:0001300) | PubMed (21661732) | Methanol extract of dried and ground stems and roots | |
| root (BTO:0001188) | PubMed (21661732) | Methanol extract of dried and ground stems and roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-dihydrokaempferol (CHEBI:15401) has functional parent kaempferol (CHEBI:28499) |
| (+)-dihydrokaempferol (CHEBI:15401) has role metabolite (CHEBI:25212) |
| (+)-dihydrokaempferol (CHEBI:15401) is a 4'-hydroxyflavanones (CHEBI:140331) |
| (+)-dihydrokaempferol (CHEBI:15401) is a dihydroflavonols (CHEBI:48039) |
| (+)-dihydrokaempferol (CHEBI:15401) is a secondary α-hydroxy ketone (CHEBI:2468) |
| (+)-dihydrokaempferol (CHEBI:15401) is a tetrahydroxyflavanone (CHEBI:38742) |
| (+)-dihydrokaempferol (CHEBI:15401) is conjugate acid of (+)-dihydrokaempferol 7-oxoanion (CHEBI:57294) |
| Incoming Relation(s) |
| 6-methoxyaromadendrin 3-O-acetate (CHEBI:2210) has functional parent (+)-dihydrokaempferol (CHEBI:15401) |
| phellamurin (CHEBI:8048) has functional parent (+)-dihydrokaempferol (CHEBI:15401) |
| (+)-dihydrokaempferol 7-oxoanion (CHEBI:57294) is conjugate base of (+)-dihydrokaempferol (CHEBI:15401) |
| IUPAC Name |
|---|
| (2R,3R)-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Dihydrokaempferol | KEGG COMPOUND |
| Aromadendrin | KEGG COMPOUND |
| (+)-Dihydrokaempferol | KEGG COMPOUND |
| (+)-Aromadendrin | KEGG COMPOUND |
| (+)-aromadendrin | ChEBI |
| UniProt Name | Source |
|---|---|
| (2R,3R)-dihydrokaempferol | UniProt |