EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O3 |
| Net Charge | 0 |
| Average Mass | 292.419 |
| Monoisotopic Mass | 292.20384 |
| SMILES | CC/C=C\C=C\O/C=C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-13-16-21-17-14-11-9-7-5-6-8-10-12-15-18(19)20/h3-4,9,11,13-14,16-17H,2,5-8,10,12,15H2,1H3,(H,19,20)/b4-3-,11-9-,16-13+,17-14+ |
| InChIKey | QWRJRLCIDLDGLM-GTTHPXIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allium sativum (ncbitaxon:4682) | bulb (BTO:0000159) | PubMed (7672118) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etherolenic acid (CHEBI:80443) has role plant metabolite (CHEBI:76924) |
| etherolenic acid (CHEBI:80443) is a divinyl ether fatty acid (CHEBI:61411) |
| etherolenic acid (CHEBI:80443) is a long-chain fatty acid (CHEBI:15904) |
| etherolenic acid (CHEBI:80443) is conjugate acid of etherolenate (CHEBI:229758) |
| Incoming Relation(s) |
| etherolenate (CHEBI:229758) is conjugate base of etherolenic acid (CHEBI:80443) |
| IUPAC Name |
|---|
| (9Z,11E)-12-[(1E,3Z)-hexa-1,3-dien-1-yloxy]dodeca-9,11-dienoic acid |
| Synonyms | Source |
|---|---|
| (9Z,11E,1'E,3'Z)-12-(1',3'-hexadienyloxy)-9,11-dodecadienoic acid | KEGG COMPOUND |
| (9Z,11E)-12-[(1E,3Z)-1,3-hexadienyloxy]-9,11-dodecadienoic acid | ChEBI |
| 12-(1'E,3'Z-hexadienyloxy)-9Z,11E-dodecadienoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C16319 | KEGG COMPOUND |
| LMFA10000003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:169217-39-4 | ChEBI |
| Citations |
|---|