EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27O3 |
| Net Charge | -1 |
| Average Mass | 291.411 |
| Monoisotopic Mass | 291.19657 |
| SMILES | CC/C=C\C=C\O/C=C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-13-16-21-17-14-11-9-7-5-6-8-10-12-15-18(19)20/h3-4,9,11,13-14,16-17H,2,5-8,10,12,15H2,1H3,(H,19,20)/p-1/b4-3-,11-9-,16-13+,17-14+ |
| InChIKey | QWRJRLCIDLDGLM-GTTHPXIQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etherolenate (CHEBI:229758) is a long-chain fatty acid anion (CHEBI:57560) |
| etherolenate (CHEBI:229758) is a oxa fatty acid anion (CHEBI:61413) |
| etherolenate (CHEBI:229758) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| etherolenate (CHEBI:229758) is conjugate base of etherolenic acid (CHEBI:80443) |
| Incoming Relation(s) |
| etherolenic acid (CHEBI:80443) is conjugate acid of etherolenate (CHEBI:229758) |
| IUPAC Name |
|---|
| (9Z,11E)-12-[(1E,3Z)-hexa-1,3-dien-1-yloxy]dodeca-9,11-dienoate |
| Synonyms | Source |
|---|---|
| (9Z,11E,1'E,3'Z)-12-(1'E,3'Z-hexadienyloxy)-9,11-dodecadienonate | SUBMITTER |
| etherolenic acid anion | ChEBI |
| (9Z,11E)-12-[(1E,3Z)-1,3-hexadienyloxy]-9,11-dodecadienoate | ChEBI |
| UniProt Name | Source |
|---|---|
| etherolenate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21297 | MetaCyc |