EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O3 |
| Net Charge | 0 |
| Average Mass | 188.182 |
| Monoisotopic Mass | 188.04734 |
| SMILES | O=C(O)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C11H8O3/c12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h1-6,12H,(H,13,14) |
| InChIKey | ALKYHXVLJMQRLQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxy-2-naphthoate (CHEBI:80383) is a naphthoic acid (CHEBI:25483) |
| Incoming Relation(s) |
| dynasore (CHEBI:132754) has functional parent 3-Hydroxy-2-naphthoate (CHEBI:80383) |
| Manual Xrefs | Databases |
|---|---|
| C16212 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:92-70-6 | KEGG COMPOUND |