EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14N2O4 |
| Net Charge | 0 |
| Average Mass | 322.320 |
| Monoisotopic Mass | 322.09536 |
| SMILES | O=C(N/N=C/c1ccc(O)c(O)c1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C18H14N2O4/c21-15-6-5-11(7-17(15)23)10-19-20-18(24)14-8-12-3-1-2-4-13(12)9-16(14)22/h1-10,21-23H,(H,20,24)/b19-10+ |
| InChIKey | SYNDQCRDGGCQRZ-VXLYETTFSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.5.5 (dynamin GTPase) inhibitor An EC 3.6.5.* (hydrolases acting on GTP; involved in cellular and subcellular movement) inhibitor that interferes with the action of dynamin GTPase (EC 3.6.5.5). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dynasore (CHEBI:132754) has functional parent 3-Hydroxy-2-naphthoate (CHEBI:80383) |
| dynasore (CHEBI:132754) has role EC 3.6.5.5 (dynamin GTPase) inhibitor (CHEBI:132772) |
| dynasore (CHEBI:132754) is a catechols (CHEBI:33566) |
| dynasore (CHEBI:132754) is a hydrazide (CHEBI:35362) |
| dynasore (CHEBI:132754) is a hydrazone (CHEBI:38532) |
| dynasore (CHEBI:132754) is a naphthols (CHEBI:25392) |
| IUPAC Name |
|---|
| N'-[(E)-(3,4-dihydroxyphenyl)methylene]-3-hydroxy-2-naphthohydrazide |
| Synonyms | Source |
|---|---|
| Dynamin Inhibitor I | SUBMITTER |
| 3-Hydroxynaphthalene-2-carboxylic acid (3,4-dihydroxybenzylidene)hydrazide | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25249841 | Reaxys |
| Reaxys:20640593 | Reaxys |
| CAS:304448-55-3 | SUBMITTER |
| Citations |
|---|