EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H54O2 |
| Net Charge | 0 |
| Average Mass | 566.870 |
| Monoisotopic Mass | 566.41238 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)CCC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H54O2/c1-29(17-13-19-31(3)21-23-36-33(5)27-35(41)28-40(36,9)10)15-11-12-16-30(2)18-14-20-32(4)22-24-37-34(6)38(42)25-26-39(37,7)8/h11-24,35,41H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-/m1/s1 |
| InChIKey | ZRCXVNZZDQGBQT-BANQPSJHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Synechocystis sp. (ncbitaxon:1148) | - | PubMed (24846130) | Strain: PCC 6803 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-hydroxyechinenone (CHEBI:80214) has functional parent echinenone (CHEBI:4746) |
| 3'-hydroxyechinenone (CHEBI:80214) has role bacterial metabolite (CHEBI:76969) |
| 3'-hydroxyechinenone (CHEBI:80214) has role biological pigment (CHEBI:26130) |
| 3'-hydroxyechinenone (CHEBI:80214) has role cofactor (CHEBI:23357) |
| 3'-hydroxyechinenone (CHEBI:80214) is a carotenone (CHEBI:35310) |
| 3'-hydroxyechinenone (CHEBI:80214) is a enone (CHEBI:51689) |
| 3'-hydroxyechinenone (CHEBI:80214) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3'R)-3'-hydroxy-β,β-caroten-4-one |
| Synonyms | Source |
|---|---|
| 3-{(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohex-1-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl}-2,4,4-trimethylcyclohex-2-en-1-one | IUPAC |
| 3'-hydroxy-β,β-caroten-4-one | ChEBI |
| (3'R)-3'-hydroxy-echinenone | ChEBI |
| 3'-OH-Echinenone | LIPID MAPS |
| hECN | ChEBI |
| HEQ | ChEBI |
| UniProt Name | Source |
|---|---|
| 3'-hydroxyechinenone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3%27-Hydroxyechinenone | Wikipedia |
| C15965 | KEGG COMPOUND |
| LMPR01070098 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6024554 | Reaxys |
| Citations |
|---|