EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H54O2 |
| Net Charge | 0 |
| Average Mass | 566.870 |
| Monoisotopic Mass | 566.41238 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)CCC2(C)C)C(C)(C)C[C@H](O)C1 |
| InChI | InChI=1S/C40H54O2/c1-29(17-13-19-31(3)21-23-36-33(5)27-35(41)28-40(36,9)10)15-11-12-16-30(2)18-14-20-32(4)22-24-37-34(6)38(42)25-26-39(37,7)8/h11-24,35,41H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-/m1/s1 |
| InChIKey | ZRCXVNZZDQGBQT-BANQPSJHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Synechocystis sp. (ncbitaxon:1148) | - | PubMed (24846130) | Strain: PCC 6803 |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-hydroxyechinenone (CHEBI:80214) has functional parent echinenone (CHEBI:4746) |
| 3'-hydroxyechinenone (CHEBI:80214) has role bacterial metabolite (CHEBI:76969) |
| 3'-hydroxyechinenone (CHEBI:80214) has role biological pigment (CHEBI:26130) |
| 3'-hydroxyechinenone (CHEBI:80214) has role cofactor (CHEBI:23357) |
| 3'-hydroxyechinenone (CHEBI:80214) is a carotenone (CHEBI:35310) |
| 3'-hydroxyechinenone (CHEBI:80214) is a enone (CHEBI:51689) |
| 3'-hydroxyechinenone (CHEBI:80214) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3'R)-3'-hydroxy-β,β-caroten-4-one |
| Synonyms | Source |
|---|---|
| 3'-OH-Echinenone | LIPID MAPS |
| HEQ | ChEBI |
| hECN | ChEBI |
| 3'-hydroxy-β,β-caroten-4-one | ChEBI |
| (3'R)-3'-hydroxy-echinenone | ChEBI |
| 3-{(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohex-1-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl}-2,4,4-trimethylcyclohex-2-en-1-one | IUPAC |
| UniProt Name | Source |
|---|---|
| 3'-hydroxyechinenone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C15965 | KEGG COMPOUND |
| LMPR01070098 | LIPID MAPS |
| 3%27-Hydroxyechinenone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6024554 | Reaxys |
| Citations |
|---|