EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H54O |
| Net Charge | 0 |
| Average Mass | 550.871 |
| Monoisotopic Mass | 550.41747 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)C(=O)CCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H54O/c1-30(18-13-20-32(3)23-25-36-34(5)22-15-28-39(36,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-37-35(6)38(41)27-29-40(37,9)10/h11-14,16-21,23-26H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+ |
| InChIKey | QXNWZXMBUKUYMD-QQGJMDNJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kocuria rosea (ncbitaxon:1275) | - | PubMed (5473895) |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| echinenone (CHEBI:4746) has parent hydride β-carotene (CHEBI:17579) |
| echinenone (CHEBI:4746) has role animal metabolite (CHEBI:75767) |
| echinenone (CHEBI:4746) has role bacterial metabolite (CHEBI:76969) |
| echinenone (CHEBI:4746) has role cofactor (CHEBI:23357) |
| echinenone (CHEBI:4746) has role marine metabolite (CHEBI:76507) |
| echinenone (CHEBI:4746) is a carotenone (CHEBI:35310) |
| Incoming Relation(s) |
| 3'-hydroxyechinenone (CHEBI:80214) has functional parent echinenone (CHEBI:4746) |
| 4'-hydroxyechinenone (CHEBI:140610) has functional parent echinenone (CHEBI:4746) |
| 4',4'-dihydroxyechinenone (CHEBI:140676) has functional parent echinenone (CHEBI:4746) |
| IUPAC Name |
|---|
| β,β-caroten-4-one |
| Synonyms | Source |
|---|---|
| 4-keto-β-carotene | ChEBI |
| 4-oxo-β-carotene | ChEBI |
| aphanin | ChEBI |
| Echinenone | KEGG COMPOUND |
| myoxanthin | ChEBI |
| UniProt Name | Source |
|---|---|
| echinenone | UniProt |
| Citations |
|---|