EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H28N6O8 |
| Net Charge | 0 |
| Average Mass | 396.401 |
| Monoisotopic Mass | 396.19686 |
| SMILES | NC(=O)NC[C@H](NC(=O)[C@H](O)[C@@H](O)[C@@H](N)[C@@H](O)C[C@H](O)[C@H](N)CO)C(N)=O |
| InChI | InChI=1S/C13H28N6O8/c14-4(3-20)6(21)1-7(22)8(15)9(23)10(24)12(26)19-5(11(16)25)2-18-13(17)27/h4-10,20-24H,1-3,14-15H2,(H2,16,25)(H,19,26)(H3,17,18,27)/t4-,5+,6+,7+,8+,9+,10-/m1/s1 |
| InChIKey | FYIPKJHNWFVEIR-FXQWNPMTSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus cereus (ncbitaxon:1396) | - | PubMed (10464220) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-zwittermicin A (CHEBI:80056) has role antifungal agent (CHEBI:35718) |
| (+)-zwittermicin A (CHEBI:80056) has role bacterial metabolite (CHEBI:76969) |
| (+)-zwittermicin A (CHEBI:80056) is a 4,8-diamino-N-[1-amino-3-(carbamoylamino)-1-oxopropan-2-yl]-2,3,5,7,9-pentahydroxynonanamide (CHEBI:167622) |
| (+)-zwittermicin A (CHEBI:80056) is a peptide antibiotic (CHEBI:25903) |
| (+)-zwittermicin A (CHEBI:80056) is enantiomer of (−)-zwittermicin A (CHEBI:167210) |
| Incoming Relation(s) |
| (−)-zwittermicin A (CHEBI:167210) is enantiomer of (+)-zwittermicin A (CHEBI:80056) |
| IUPAC Name |
|---|
| (2R,3S,4S,5S,7S,8R)-4,8-diamino-N-[(2S)-1-amino-3-(carbamoylamino)-1-oxopropan-2-yl]-2,3,5,7,9-pentahydroxynonanamide |
| Synonym | Source |
|---|---|
| (+)-zwittermicin A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C15726 | KEGG COMPOUND |
| CPD-18237 | MetaCyc |
| EP1163347 | Patent |
| Zwittermicin_A | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:155547-95-8 | ChemIDplus |
| Citations |
|---|