EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H28N6O8 |
| Net Charge | 0 |
| Average Mass | 396.401 |
| Monoisotopic Mass | 396.19686 |
| SMILES | NC(=O)NC[C@@H](NC(=O)[C@@H](O)[C@H](O)[C@H](N)[C@H](O)C[C@@H](O)[C@@H](N)CO)C(N)=O |
| InChI | InChI=1S/C13H28N6O8/c14-4(3-20)6(21)1-7(22)8(15)9(23)10(24)12(26)19-5(11(16)25)2-18-13(17)27/h4-10,20-24H,1-3,14-15H2,(H2,16,25)(H,19,26)(H3,17,18,27)/t4-,5+,6+,7+,8+,9+,10-/m0/s1 |
| InChIKey | FYIPKJHNWFVEIR-OLIAHSIJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-zwittermicin A (CHEBI:167210) is a 4,8-diamino-N-[1-amino-3-(carbamoylamino)-1-oxopropan-2-yl]-2,3,5,7,9-pentahydroxynonanamide (CHEBI:167622) |
| (−)-zwittermicin A (CHEBI:167210) is enantiomer of (+)-zwittermicin A (CHEBI:80056) |
| Incoming Relation(s) |
| (+)-zwittermicin A (CHEBI:80056) is enantiomer of (−)-zwittermicin A (CHEBI:167210) |
| IUPAC Name |
|---|
| (2S,3R,4R,5R,7R,8S)-4,8-diamino-N-[(2R)-1-amino-3-(carbamoylamino)-1-oxopropan-2-yl]-2,3,5,7,9-pentahydroxynonanamide |
| Synonyms | Source |
|---|---|
| (−)-zwittermicin A | ChEBI |
| (−)-ent-zwittermicin A | ChEBI |
| Citations |
|---|