EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H39N5O6 |
| Net Charge | 0 |
| Average Mass | 493.605 |
| Monoisotopic Mass | 493.29003 |
| SMILES | [H][C@]1(NC(=O)[C@@H](NC(=O)N[C@H](C(=O)O)C(C)C)C(C)C)/C=C/CCNC(=O)/C=C/[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C24H39N5O6/c1-13(2)16-10-11-18(30)25-12-8-7-9-17(21(31)26-16)27-22(32)19(14(3)4)28-24(35)29-20(15(5)6)23(33)34/h7,9-11,13-17,19-20H,8,12H2,1-6H3,(H,25,30)(H,26,31)(H,27,32)(H,33,34)(H2,28,29,35)/b9-7+,11-10+/t16-,17+,19+,20+/m1/s1 |
| InChIKey | RUWSLQOIGKYPEZ-YPXRAQKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas syringae pv. syringae (ncbitaxon:1365665) | - | PubMed (14714872) | Strain: B301D-R |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| syringolin A (CHEBI:80033) has role bacterial metabolite (CHEBI:76969) |
| syringolin A (CHEBI:80033) is a homodetic cyclic peptide (CHEBI:24613) |
| syringolin A (CHEBI:80033) is a monocarboxylic acid (CHEBI:25384) |
| syringolin A (CHEBI:80033) is a syrbactin (CHEBI:82671) |
| syringolin A (CHEBI:80033) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (2S)-2-({[(2S)-1-{[(3E,5S,8S,9E)-5-isopropyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]amino}-3-methyl-1-oxobutan-2-yl]carbamoyl}amino)-3-methylbutanoic acid |
| Citations |
|---|