EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O2 |
| Net Charge | 0 |
| Average Mass | 122.123 |
| Monoisotopic Mass | 122.03678 |
| SMILES | O=c1cccccc1O |
| InChI | InChI=1S/C7H6O2/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H,8,9) |
| InChIKey | MDYOLVRUBBJPFM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia plantarii (ncbitaxon:41899) | - | PubMed (27002128) |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropolone (CHEBI:79966) has parent hydride cyclohepta-1,3,5-triene (CHEBI:37519) |
| tropolone (CHEBI:79966) has role bacterial metabolite (CHEBI:76969) |
| tropolone (CHEBI:79966) has role fungicide (CHEBI:24127) |
| tropolone (CHEBI:79966) has role toxin (CHEBI:27026) |
| tropolone (CHEBI:79966) is a cyclic ketone (CHEBI:3992) |
| tropolone (CHEBI:79966) is a enol (CHEBI:33823) |
| tropolone (CHEBI:79966) is a α-hydroxy ketone (CHEBI:139588) |
| Incoming Relation(s) |
| 3,7-dihydroxytropolone (CHEBI:156362) has functional parent tropolone (CHEBI:79966) |
| IUPAC Name |
|---|
| 2-hydroxycyclohepta-2,4,6-trien-1-one |
| Synonyms | Source |
|---|---|
| 2-hydroxy-2,4,6-cycloheptatrien-1-one | NIST Chemistry WebBook |
| 2-hydroxycyclohepta-2,4,6-trienone | ChemIDplus |
| 2-hydroxytropone | ChemIDplus |
| purpurocatechol | ChemIDplus |
| Citations |
|---|