EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O4 |
| Net Charge | 0 |
| Average Mass | 154.121 |
| Monoisotopic Mass | 154.02661 |
| SMILES | O=c1c(O)cccc(O)c1O |
| InChI | InChI=1S/C7H6O4/c8-4-2-1-3-5(9)7(11)6(4)10/h1-3H,(H3,8,9,10,11) |
| InChIKey | HQLHJCFATKAUSO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2925523) | Strain: K611-97 |
| Streptomyces tropolofaciens (ncbitaxon:1883) | cell suspension culture (BTO:0000221) | PubMed (3417559) | Strain: K611-97 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-dihydroxytropolone (CHEBI:156362) has functional parent tropolone (CHEBI:79966) |
| 3,7-dihydroxytropolone (CHEBI:156362) has role antineoplastic agent (CHEBI:35610) |
| 3,7-dihydroxytropolone (CHEBI:156362) has role bacterial metabolite (CHEBI:76969) |
| 3,7-dihydroxytropolone (CHEBI:156362) is a cyclic ketone (CHEBI:3992) |
| 3,7-dihydroxytropolone (CHEBI:156362) is a enol (CHEBI:33823) |
| 3,7-dihydroxytropolone (CHEBI:156362) is a triol (CHEBI:27136) |
| 3,7-dihydroxytropolone (CHEBI:156362) is a α-hydroxy ketone (CHEBI:139588) |
| IUPAC Name |
|---|
| 2,3,7-trihydroxycyclohepta-2,4,6-trien-1-one |
| Synonyms | Source |
|---|---|
| BMY-28438 | ChemIDplus |
| 2,3,7-trihydroxy-2,4,6-cycloheptatrien-1-one | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,7-dihydroxytropolone | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:85233-29-0 | ChemIDplus |
| Citations |
|---|