EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C18H29NO2.H2O4S |
| Net Charge | 0 |
| Average Mass | 680.949 |
| Monoisotopic Mass | 680.40704 |
| SMILES | CC(C)(C)NC[C@H](O)COc1ccccc1C1CCCC1.CC(C)(C)NC[C@H](O)COc1ccccc1C1CCCC1.O=S(=O)(O)O |
| InChI | InChI=1S/2C18H29NO2.H2O4S/c2*1-18(2,3)19-12-15(20)13-21-17-11-7-6-10-16(17)14-8-4-5-9-14;1-5(2,3)4/h2*6-7,10-11,14-15,19-20H,4-5,8-9,12-13H2,1-3H3;(H2,1,2,3,4)/t2*15-;/m00./s1 |
| InChIKey | FEDSNBHHWZEYTP-ZFQYHYQMSA-N |
| Roles Classification |
|---|
| Biological Role: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| Application: | beta-adrenergic antagonist An agent that binds to but does not activate β-adrenergic receptors thereby blocking the actions of endogenous or exogenous β-adrenergic agonists. β-Adrenergic antagonists are used for treatment of hypertension, cardiac arrhythmias, angina pectoris, glaucoma, migraine headaches and anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penbutolol sulfate (CHEBI:7955) has functional parent penbutolol (CHEBI:7954) |
| penbutolol sulfate (CHEBI:7955) has role β-adrenergic antagonist (CHEBI:35530) |
| penbutolol sulfate (CHEBI:7955) is a ethanolamine sulfate salt (CHEBI:38016) |
| Synonyms | Source |
|---|---|
| Penbutolol sulfate | KEGG COMPOUND |
| Levatol (TN) | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D00602 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:38363-32-5 | KEGG COMPOUND |