EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO2 |
| Net Charge | 0 |
| Average Mass | 291.435 |
| Monoisotopic Mass | 291.21983 |
| SMILES | CC(C)(C)NC[C@H](O)COc1ccccc1C1CCCC1 |
| InChI | InChI=1S/C18H29NO2/c1-18(2,3)19-12-15(20)13-21-17-11-7-6-10-16(17)14-8-4-5-9-14/h6-7,10-11,14-15,19-20H,4-5,8-9,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | KQXKVJAGOJTNJS-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| penbutolol (CHEBI:7954) has role cardiovascular drug (CHEBI:35554) |
| penbutolol (CHEBI:7954) is a ethanolamines (CHEBI:23981) |
| Incoming Relation(s) |
| penbutolol sulfate (CHEBI:7955) has functional parent penbutolol (CHEBI:7954) |
| Synonyms | Source |
|---|---|
| betapressin | DrugCentral |
| (-)-isopenbutolol | ChEMBL |
| levopenbutolol | DrugCentral |
| (-)-penbutolol | ChEMBL |
| Penbutolol | KEGG COMPOUND |
| penbutolol sulfate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2078 | DrugCentral |
| C07416 | KEGG COMPOUND |
| D08074 | KEGG DRUG |
| HMDB0015447 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:38363-40-5 | KEGG COMPOUND |
| Citations |
|---|