EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18CuN4O2S2 |
| Net Charge | 0 |
| Average Mass | 462.059 |
| Monoisotopic Mass | 461.01672 |
| SMILES | CN1C(c2ccccc2)=[S+][Cu-2]23[S+]=C(c4ccccc4)N(C)[N]2C(=O)CC(=O)[N]13 |
| InChI | InChI=1S/C19H20N4O2S2.Cu/c1-22(18(26)14-9-5-3-6-10-14)20-16(24)13-17(25)21-23(2)19(27)15-11-7-4-8-12-15;/h3-12H,13H2,1-2H3,(H2,20,21,24,25);/q;+2/p-2 |
| InChIKey | UUSCWIGUMPDFDE-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elesclomol-Cu(II) (CHEBI:79377) has part elesclomol (CHEBI:79369) |
| elesclomol-Cu(II) (CHEBI:79377) has role antineoplastic agent (CHEBI:35610) |
| elesclomol-Cu(II) (CHEBI:79377) has role apoptosis inducer (CHEBI:68495) |
| elesclomol-Cu(II) (CHEBI:79377) is a copper coordination entity (CHEBI:37403) |
| IUPAC Name |
|---|
| {N'1,N'3-dimethyl-N'1,N'3-bis[phenyl(thioxo-κS)methyl]malonohydrazido(2−)-κ2N1,N3}copper |
| Synonyms | Source |
|---|---|
| elesclomol-copper | ChEBI |
| elesclomol-Cu | ChEBI |
| elesclomol-Cu(2+) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2013071106 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24095943 | Reaxys |