EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21NO9S3 |
| Net Charge | 0 |
| Average Mass | 419.499 |
| Monoisotopic Mass | 419.03784 |
| SMILES | CS(=O)C=CCC/C(=N/S(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H21NO9S3/c1-24(18)5-3-2-4-8(13-25(19,20)21)23-12-11(17)10(16)9(15)7(6-14)22-12/h3,5,7,9-12,14-17H,2,4,6H2,1H3,(H,19,20,21)/b5-3?,13-8-/t7-,9-,10+,11-,12+,24?/m1/s1 |
| InChIKey | HWABDHHTQMTFMW-OOLORDSESA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoraphenin (CHEBI:79367) has functional parent gluconapin (CHEBI:79319) |
| glucoraphenin (CHEBI:79367) is a glucosinolic acid (CHEBI:79316) |
| glucoraphenin (CHEBI:79367) is a sulfoxide (CHEBI:22063) |
| glucoraphenin (CHEBI:79367) is conjugate acid of glucoraphenin(1−) (CHEBI:5416) |
| Incoming Relation(s) |
| 6-sinapoylglucoraphenin (CHEBI:136943) has functional parent glucoraphenin (CHEBI:79367) |
| glucoraphenin(1−) (CHEBI:5416) is conjugate base of glucoraphenin (CHEBI:79367) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-5-(methylsulfinyl)-N-(sulfooxy)pent-4-enimidoyl]-1-thio-β-D-glucopyranose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8941049 | Reaxys |
| CAS:28463-24-3 | ChemIDplus |
| Citations |
|---|