EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H31NO13S3 |
| Net Charge | 0 |
| Average Mass | 625.696 |
| Monoisotopic Mass | 625.09575 |
| SMILES | COc1cc(/C=C/C(=O)OC[C@H]2O[C@@H](S/C(CCC=CS(C)=O)=N\S(=O)(=O)O)[C@H](O)[C@@H](O)[C@@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C23H31NO13S3/c1-34-14-10-13(11-15(35-2)19(14)26)7-8-18(25)36-12-16-20(27)21(28)22(29)23(37-16)38-17(24-40(31,32)33)6-4-5-9-39(3)30/h5,7-11,16,20-23,26-29H,4,6,12H2,1-3H3,(H,31,32,33)/b8-7+,9-5?,24-17-/t16-,20-,21+,22-,23+,39?/m1/s1 |
| InChIKey | ZNEJWXHAVJTYSO-RUSIJVCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) |
| Roles Classification |
|---|
| Biological Roles: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-sinapoylglucoraphenin (CHEBI:136943) has functional parent trans-sinapic acid (CHEBI:15714) |
| 6-sinapoylglucoraphenin (CHEBI:136943) has functional parent glucoraphenin (CHEBI:79367) |
| 6-sinapoylglucoraphenin (CHEBI:136943) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 6-sinapoylglucoraphenin (CHEBI:136943) is a cinnamate ester (CHEBI:36087) |
| 6-sinapoylglucoraphenin (CHEBI:136943) is a glucosinolic acid (CHEBI:79316) |
| 6-sinapoylglucoraphenin (CHEBI:136943) is a sulfoxide (CHEBI:22063) |
| IUPAC Name |
|---|
| 6-O-[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-S-[(1Z)-5-(methanesulfinyl)-N-sulfopent-4-enimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 6-(transsinapoyl)glucoraphenin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 35014565 | ChemSpider |
| HMDB0038405 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:76653-80-0 | HMDB |