EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H45NO8 |
| Net Charge | 0 |
| Average Mass | 547.689 |
| Monoisotopic Mass | 547.31452 |
| SMILES | C[C@H](CCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C30H45NO8/c1-20(13-9-7-5-3-4-6-8-10-14-22(32)17-28(34)35)37-30-26(33)18-27(21(2)38-30)39-29(36)24-19-31-25-16-12-11-15-23(24)25/h11-12,15-16,19-22,26-27,30-33H,3-10,13-14,17-18H2,1-2H3,(H,34,35)/t20-,21+,22-,26-,27-,30-/m1/s1 |
| InChIKey | UWTXRGDQDGZEBX-RZEARGRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibha#26 (CHEBI:79358) has functional parent (3R,14R)-3,14-dihydroxypentadecanoic acid (CHEBI:79247) |
| ibha#26 (CHEBI:79358) has functional parent bhas#26 (CHEBI:79233) |
| ibha#26 (CHEBI:79358) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ibha#26 (CHEBI:79358) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ibha#26 (CHEBI:79358) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| ibha#26 (CHEBI:79358) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| ibha#26 (CHEBI:79358) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3R,14R)-14-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}-3-hydroxypentadecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-14R-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-pentadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ibha%2326%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233530 | Reaxys |
| CAS:1355683-32-7 | SMID |
| Citations |
|---|