EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40O7 |
| Net Charge | 0 |
| Average Mass | 404.544 |
| Monoisotopic Mass | 404.27740 |
| SMILES | C[C@H](CCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H40O7/c1-15(27-21-19(24)14-18(23)16(2)28-21)11-9-7-5-3-4-6-8-10-12-17(22)13-20(25)26/h15-19,21-24H,3-14H2,1-2H3,(H,25,26)/t15-,16+,17-,18-,19-,21-/m1/s1 |
| InChIKey | WDFCEBWMCPQIFZ-XBIRKDKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) as well as maoc-1(hj13) and acox-1(ok2257) mutant worms. It is a major ascaroside in dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#26 (CHEBI:79233) has functional parent (3R,14R)-3,14-dihydroxypentadecanoic acid (CHEBI:79247) |
| bhas#26 (CHEBI:79233) has functional parent ascr#26 (CHEBI:78964) |
| bhas#26 (CHEBI:79233) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#26 (CHEBI:79233) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#26 (CHEBI:79233) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#26 (CHEBI:79233) is a monocarboxylic acid (CHEBI:25384) |
| bhas#26 (CHEBI:79233) is conjugate acid of bhas#26(1-) (CHEBI:139747) |
| Incoming Relation(s) |
| ibha#26 (CHEBI:79358) has functional parent bhas#26 (CHEBI:79233) |
| bhas#26(1-) (CHEBI:139747) is conjugate base of bhas#26 (CHEBI:79233) |
| IUPAC Name |
|---|
| (3R,14R)-14-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxypentadecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-14R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-pentadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2326%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233456 | Reaxys |
| CAS:1355682-58-4 | SMID |
| Citations |
|---|