EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO10S2 |
| Net Charge | 0 |
| Average Mass | 389.404 |
| Monoisotopic Mass | 389.04504 |
| SMILES | C=C[C@@H](O)CC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/t5-,6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | MYHSVHWQEVDFQT-AUYZFIFFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crambe abyssinica (ncbitaxon:3721) | seed (BTO:0001226) | DOI ( 10.1111/j.1439-0523.2003.00893.x ) | |
| Isatis indigotica (ncbitaxon:161756) | root (BTO:0001188) | PubMed (29844266) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epi-progoitrin (CHEBI:79351) has role plant metabolite (CHEBI:76924) |
| epi-progoitrin (CHEBI:79351) is a ξ-progoitrin (CHEBI:79350) |
| epi-progoitrin (CHEBI:79351) is conjugate acid of epi-progoitrin(1−) (CHEBI:47797) |
| Incoming Relation(s) |
| epi-progoitrin(1−) (CHEBI:47797) is conjugate base of epi-progoitrin (CHEBI:79351) |
| IUPAC Name |
|---|
| 1-S-[(3S)-3-hydroxy-N-(sulfooxy)pent-4-enimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| (2S)-2-hydroxy-3-butenyl glucosinolate | ChEBI |
| (S)-2-hydroxy-but-3-enyl-glucosinolate | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9951982 | Reaxys |
| CAS:19237-18-4 | ChemIDplus |
| Citations |
|---|