EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO10S2 |
| Net Charge | 0 |
| Average Mass | 389.404 |
| Monoisotopic Mass | 389.04504 |
| SMILES | C=CC(O)CC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO10S2/c1-2-5(14)3-7(12-22-24(18,19)20)23-11-10(17)9(16)8(15)6(4-13)21-11/h2,5-6,8-11,13-17H,1,3-4H2,(H,18,19,20)/t5?,6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | MYHSVHWQEVDFQT-RNFCHCRPSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ξ-progoitrin (CHEBI:79350) has functional parent gluconapin (CHEBI:79319) |
| ξ-progoitrin (CHEBI:79350) is a hydroxy-alkenylglucosinolic acid (CHEBI:79348) |
| ξ-progoitrin (CHEBI:79350) is a secondary alcohol (CHEBI:35681) |
| ξ-progoitrin (CHEBI:79350) is conjugate acid of ξ-progoitrin(1−) (CHEBI:47798) |
| Incoming Relation(s) |
| epi-progoitrin (CHEBI:79351) is a ξ-progoitrin (CHEBI:79350) |
| progoitrin (CHEBI:79352) is a ξ-progoitrin (CHEBI:79350) |
| ξ-progoitrin(1−) (CHEBI:47798) is conjugate base of ξ-progoitrin (CHEBI:79350) |
| IUPAC Name |
|---|
| 1-S-[3-hydroxy-N-(sulfooxy)pent-4-enimidoyl]-1-thio-β-D-glucopyranose |