EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO10S2 |
| Net Charge | 0 |
| Average Mass | 439.464 |
| Monoisotopic Mass | 439.06069 |
| SMILES | COc1cccc(C/C(=N/OS(=O)(=O)O)S[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C15H21NO10S2/c1-24-9-4-2-3-8(5-9)6-11(16-26-28(21,22)23)27-15-14(20)13(19)12(18)10(7-17)25-15/h2-5,10,12-15,17-20H,6-7H2,1H3,(H,21,22,23)/b16-11-/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | RYDIUEJGEAUJAI-OOMJLXHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Limnanthes alba (ncbitaxon:42439) | - | PubMed (19170637) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucolimnanthin (CHEBI:79343) is a aralkylglucosinolic acid (CHEBI:79342) |
| glucolimnanthin (CHEBI:79343) is a monomethoxybenzene (CHEBI:25235) |
| glucolimnanthin (CHEBI:79343) is conjugate acid of glucolimnanthin(1−) (CHEBI:5409) |
| Incoming Relation(s) |
| glucolimnanthin(1−) (CHEBI:5409) is conjugate base of glucolimnanthin (CHEBI:79343) |
| IUPAC Name |
|---|
| 1-S-[2-(3-methoxyphenyl)-N-(sulfooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9296269 | Reaxys |
| CAS:111810-95-8 | ChemIDplus |
| Citations |
|---|