EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20NO10S2 |
| Net Charge | -1 |
| Average Mass | 438.456 |
| Monoisotopic Mass | 438.05341 |
| SMILES | COc1cccc(C/C(=N/OS(=O)(=O)[O-])S[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C15H21NO10S2/c1-24-9-4-2-3-8(5-9)6-11(16-26-28(21,22)23)27-15-14(20)13(19)12(18)10(7-17)25-15/h2-5,10,12-15,17-20H,6-7H2,1H3,(H,21,22,23)/p-1/b16-11-/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | RYDIUEJGEAUJAI-OOMJLXHVSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Limnanthes alba (ncbitaxon:42439) | - | PubMed (19170637) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucolimnanthin(1−) (CHEBI:5409) has functional parent glucotropeolin (CHEBI:17127) |
| glucolimnanthin(1−) (CHEBI:5409) is a aralkylglucosinolate (CHEBI:36452) |
| glucolimnanthin(1−) (CHEBI:5409) is conjugate base of glucolimnanthin (CHEBI:79343) |
| Incoming Relation(s) |
| glucolimnanthin (CHEBI:79343) is conjugate acid of glucolimnanthin(1−) (CHEBI:5409) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-2-(3-methoxyphenyl)-N-(sulfonatooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Glucolimnanthin | KEGG COMPOUND |
| 3-methoxybenzylglucosinolate | ChEBI |