EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO9S3 |
| Net Charge | 0 |
| Average Mass | 421.515 |
| Monoisotopic Mass | 421.05349 |
| SMILES | CSCCCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO9S3/c1-23-5-3-2-4-8(13-22-25(18,19)20)24-12-11(17)10(16)9(15)7(6-14)21-12/h7,9-12,14-17H,2-6H2,1H3,(H,18,19,20)/b13-8-/t7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | GKUMMDFLKGFCKH-AHMUMSBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Raphanus sativus (ncbitaxon:3726) | - | PubMed (24176362) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoerucin (CHEBI:79325) is a organic sulfide (CHEBI:16385) |
| glucoerucin (CHEBI:79325) is a thia-alkylglucosinolic acid (CHEBI:79322) |
| glucoerucin (CHEBI:79325) is conjugate acid of glucoerucin(1−) (CHEBI:5404) |
| Incoming Relation(s) |
| glucoraphanin (CHEBI:79311) has functional parent glucoerucin (CHEBI:79325) |
| glucoerucin(1−) (CHEBI:5404) is conjugate base of glucoerucin (CHEBI:79325) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-5-(methylsulfanyl)-N-(sulfooxy)pentanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 4-Methylthiobutyl glucosinolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08409 | KEGG COMPOUND |
| HMDB0038403 | HMDB |
| C00007344 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:53421 | Reaxys |
| CAS:21973-56-8 | ChemIDplus |
| CAS:21973-56-8 | KEGG COMPOUND |
| Citations |
|---|